CAS 314248-24-3 appears in our catalog under these names: COH34 analog 1, 98%, COH34 analog 1, COH34 analog 1/ 98.77% (existing batch purity), N-[(1E)-(2-hydroxynaphthalen-1-yl)methylidene]-4-methylbenzene-1-sulfonamide, 95%, 95%, COH34 analog 1, 98.75%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
(NE)-N-[(2-hydroxynaphthalen-1-yl)methylidene]-4-methylbenzenesulfonamide (CAS 314248-24-3) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: (NE)-N-[(2-hydroxynaphthalen-1-yl)methylidene]-4-methylbenzenesulfonamide. InChIKey: WCYGPLQLYOSVIH-XDHOZWIPSA-N.
| Molecular formula | C18H15NO3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (NE)-N-[(2-hydroxynaphthalen-1-yl)methylidene]-4-methylbenzenesulfonamide |
| InChIKey | WCYGPLQLYOSVIH-XDHOZWIPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/N=C/C2=C(C=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)