Products 748786-61-0

CAS 748786-61-0 is the registry number for 3-(1,3-Benzothiazol-2-yl)-4-(3-methoxyphenyl)but-3-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(E)-3-(1,3-benzothiazol-2-yl)-4-(3-methoxyphenyl)but-3-enoic acid (CAS 748786-61-0) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: (E)-3-(1,3-benzothiazol-2-yl)-4-(3-methoxyphenyl)but-3-enoic acid. InChIKey: INZMANTZZFBIJO-UKTHLTGXSA-N.

Identity
Molecular formulaC18H15NO3S
Molecular weight325.4 g/mol
IUPAC name(E)-3-(1,3-benzothiazol-2-yl)-4-(3-methoxyphenyl)but-3-enoic acid
InChIKeyINZMANTZZFBIJO-UKTHLTGXSA-N
SMILESCOC1=CC=CC(=C1)/C=C(\CC(=O)O)/C2=NC3=CC=CC=C3S2

Computed by PubChem (NCBI)