Products 106308-50-3

CAS 106308-50-3 is the registry number for 1-(2,6-Difluorobenzyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-[(2,6-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid (CAS 106308-50-3) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 253.20 g/mol. IUPAC name: 1-[(2,6-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid. InChIKey: BSKYMXVRPQKKNE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F2N3O2
Molecular weight253.20 g/mol
IUPAC name1-[(2,6-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid
InChIKeyBSKYMXVRPQKKNE-UHFFFAOYSA-N
SMILESCC1=C(N=NN1CC2=C(C=CC=C2F)F)C(=O)O

Computed by PubChem (NCBI)