Products 1346597-78-1
CAS 1346597-78-1 appears in our catalog under these names: 1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxylic Acid Methyl Ester-d2, Methyl 1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylate-d2. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
Methyl 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxylate (CAS 1346597-78-1) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 255.22 g/mol. IUPAC name: methyl 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxylate. InChIKey: XVEURJOWGBWEPY-BFWBPSQCSA-N.
| Molecular formula | C11H9F2N3O2 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | methyl 1-[dideuterio-(2,6-difluorophenyl)methyl]triazole-4-carboxylate |
| InChIKey | XVEURJOWGBWEPY-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C1=C(C=CC=C1F)F)N2C=C(N=N2)C(=O)OC |
Computed by PubChem (NCBI)