CAS 1159940-85-8 is the registry number for 3-{((2,3-Difluorophenyl)methyl)amino}-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(2,3-difluorophenyl)methylamino]-1H-pyrazole-5-carboxylic acid (CAS 1159940-85-8) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 253.20 g/mol. IUPAC name: 3-[(2,3-difluorophenyl)methylamino]-1H-pyrazole-5-carboxylic acid. InChIKey: DMPYCOCSGHMHJY-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O2 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | 3-[(2,3-difluorophenyl)methylamino]-1H-pyrazole-5-carboxylic acid |
| InChIKey | DMPYCOCSGHMHJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CNC2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)