CAS 1264049-61-7 is the registry number for Methyl 5-amino-1-(2,4-difluorophenyl)-1H-pyrazole-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate (CAS 1264049-61-7) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 253.20 g/mol. IUPAC name: methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate. InChIKey: RYGPGISEONBLKV-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O2 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate |
| InChIKey | RYGPGISEONBLKV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=C1)C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)