Products 1474074-86-6

CAS 1474074-86-6 is the registry number for Ethyl 5-(2,4-difluorophenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-(2,4-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1474074-86-6) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 253.20 g/mol. IUPAC name: ethyl 3-(2,4-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: NVTBNJLUWKFEGU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F2N3O2
Molecular weight253.20 g/mol
IUPAC nameethyl 3-(2,4-difluorophenyl)-1H-1,2,4-triazole-5-carboxylate
InChIKeyNVTBNJLUWKFEGU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NN1)C2=C(C=C(C=C2)F)F

Computed by PubChem (NCBI)