CAS 1351847-63-6 appears in our catalog under these names: 1-(2,4-Difluorobenzyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1-((2,4-Difluorophenyl)methyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(2,4-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid (CAS 1351847-63-6) is a chemical compound with the molecular formula C11H9F2N3O2 and a molecular weight of 253.20 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid. InChIKey: RVEFZGIMFQVYCE-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O2 |
|---|---|
| Molecular weight | 253.20 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)methyl]-5-methyltriazole-4-carboxylic acid |
| InChIKey | RVEFZGIMFQVYCE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=C(C=C(C=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)