Products 1063629-97-9

CAS 1063629-97-9 is the registry number for Ammonium (2,3-dihydro-1,4-benzodioxin-2-ylmethoxy)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Azane;2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)acetic acid (CAS 1063629-97-9) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: azane;2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)acetic acid. InChIKey: FLCZGQXSRHIBEG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO5
Molecular weight241.24 g/mol
IUPAC nameazane;2-(2,3-dihydro-1,4-benzodioxin-3-ylmethoxy)acetic acid
InChIKeyFLCZGQXSRHIBEG-UHFFFAOYSA-N
SMILESC1C(OC2=CC=CC=C2O1)COCC(=O)O.N

Computed by PubChem (NCBI)