CAS 2143005-97-2 is the registry number for Ammonium 2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Azane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid (CAS 2143005-97-2) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: azane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid. InChIKey: RELFDNOBWJZZIC-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | azane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid |
| InChIKey | RELFDNOBWJZZIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC2=C(C=C1)OCO2.N |
Computed by PubChem (NCBI)