Products 2143005-97-2

CAS 2143005-97-2 is the registry number for Ammonium 2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Azane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid (CAS 2143005-97-2) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: azane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid. InChIKey: RELFDNOBWJZZIC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO5
Molecular weight241.24 g/mol
IUPAC nameazane;2-(1,3-benzodioxol-5-yloxy)-2-methylpropanoic acid
InChIKeyRELFDNOBWJZZIC-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)OC1=CC2=C(C=C1)OCO2.N

Computed by PubChem (NCBI)