Products 106428-06-2

CAS 106428-06-2 is the registry number for 3-Fluoro-2-methoxybenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-2-methoxybenzoyl chloride (CAS 106428-06-2) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 3-fluoro-2-methoxybenzoyl chloride. InChIKey: WJLYPIGIRQBXFF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO2
Molecular weight188.58 g/mol
IUPAC name3-fluoro-2-methoxybenzoyl chloride
InChIKeyWJLYPIGIRQBXFF-UHFFFAOYSA-N
SMILESCOC1=C(C=CC=C1F)C(=O)Cl

Computed by PubChem (NCBI)