Products 106464-24-8
CAS 106464-24-8 is the registry number for AY-30068. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-[(1S,4R)-8-ethyl-4-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetate (CAS 106464-24-8) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: ethyl 2-[(1S,4R)-8-ethyl-4-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetate. InChIKey: CCBNJIRTSXFNHY-HOTGVXAUSA-N.
| Molecular formula | C21H27NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | ethyl 2-[(1S,4R)-8-ethyl-4-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetate |
| InChIKey | CCBNJIRTSXFNHY-HOTGVXAUSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=C(N2)[C@@H](CC[C@@H]3CC=C)CC(=O)OCC |
Computed by PubChem (NCBI)