CAS 1607436-59-8 is the registry number for 5-Acetyl-2-(2,4-di-tert-butylphenoxy) pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-[6-(2,4-ditert-butylphenoxy)-3-pyridinyl]ethanone (CAS 1607436-59-8) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: 1-[6-(2,4-ditert-butylphenoxy)-3-pyridinyl]ethanone. InChIKey: ZFWRIMLJVMJIRU-UHFFFAOYSA-N.
| Molecular formula | C21H27NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 1-[6-(2,4-ditert-butylphenoxy)-3-pyridinyl]ethanone |
| InChIKey | ZFWRIMLJVMJIRU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CN=C(C=C1)OC2=C(C=C(C=C2)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)