CAS 2128653-62-1 is the registry number for Sacubitril Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate (CAS 2128653-62-1) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: propan-2-yl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate. InChIKey: ATKCLYOBWADYJT-UZLBHIALSA-N.
| Molecular formula | C21H27NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | propan-2-yl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate |
| InChIKey | ATKCLYOBWADYJT-UZLBHIALSA-N |
| SMILES | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N)C(=O)OC(C)C |
Computed by PubChem (NCBI)