CAS 33318-28-4 is the registry number for (1S,2R)-1-Benzyl-3-(dimethylamino)-2-methyl-1-phenylpropyl Acetate (Acetoxyphene). Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
[(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate (CAS 33318-28-4) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate. InChIKey: WPOZMXNNOJHTDY-UTKZUKDTSA-N.
| Molecular formula | C21H27NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate |
| InChIKey | WPOZMXNNOJHTDY-UTKZUKDTSA-N |
| SMILES | C[C@H](CN(C)C)[C@@](CC1=CC=CC=C1)(C2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)