Products 53990-51-5

CAS 53990-51-5 is the registry number for α-(2-(Dimethylamino)-1-methylethyl)-α-phenyl-benzeneethanol 1-acetate. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

[4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate (CAS 53990-51-5) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: [4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate. InChIKey: WPOZMXNNOJHTDY-UHFFFAOYSA-N.

Identity
Molecular formulaC21H27NO2
Molecular weight325.4 g/mol
IUPAC name[4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] acetate
InChIKeyWPOZMXNNOJHTDY-UHFFFAOYSA-N
SMILESCC(CN(C)C)C(CC1=CC=CC=C1)(C2=CC=CC=C2)OC(=O)C

Computed by PubChem (NCBI)