CAS 40220-79-9 appears in our catalog under these names: Diphenidol Impurity 11, Difenidol N-Oxide. Offered by: Hubei YoungXin, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-(1-oxidopiperidin-1-ium-1-yl)-1,1-diphenylbutan-1-ol (CAS 40220-79-9) is a chemical compound with the molecular formula C21H27NO2 and a molecular weight of 325.4 g/mol. IUPAC name: 4-(1-oxidopiperidin-1-ium-1-yl)-1,1-diphenylbutan-1-ol. InChIKey: BVMACPVGCLLIIH-UHFFFAOYSA-N.
| Molecular formula | C21H27NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 4-(1-oxidopiperidin-1-ium-1-yl)-1,1-diphenylbutan-1-ol |
| InChIKey | BVMACPVGCLLIIH-UHFFFAOYSA-N |
| SMILES | C1CC[N+](CC1)(CCCC(C2=CC=CC=C2)(C3=CC=CC=C3)O)[O-] |
Computed by PubChem (NCBI)