CAS 1064704-03-5 is the registry number for 1-Ethyl-3-(hydroxymethyl)pyridinium Ethyl Sulfate. Offered by: TCI, Chemat. Available pack sizes: 5g, 1g.
(1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate (CAS 1064704-03-5) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: (1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate. InChIKey: CIWXUAJJMSQGND-UHFFFAOYSA-M.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | (1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate |
| InChIKey | CIWXUAJJMSQGND-UHFFFAOYSA-M |
| SMILES | CC[N+]1=CC=CC(=C1)CO.CCOS(=O)(=O)[O-] |
Computed by PubChem (NCBI)