Products 1064704-03-5

CAS 1064704-03-5 is the registry number for 1-Ethyl-3-(hydroxymethyl)pyridinium Ethyl Sulfate. Offered by: TCI, Chemat. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

(1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate (CAS 1064704-03-5) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: (1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate. InChIKey: CIWXUAJJMSQGND-UHFFFAOYSA-M.

Identity
Molecular formulaC10H17NO5S
Molecular weight263.31 g/mol
IUPAC name(1-ethylpyridin-1-ium-3-yl)methanol;ethyl sulfate
InChIKeyCIWXUAJJMSQGND-UHFFFAOYSA-M
SMILESCC[N+]1=CC=CC(=C1)CO.CCOS(=O)(=O)[O-]

Computed by PubChem (NCBI)