Products 4312-54-3
CAS 4312-54-3 appears in our catalog under these names: 3-Hydroxyphenyltrimethylammonium Methyl Sulfate, Neostigmine EP Impurity A Metilsulfate, Neostigmine Impurity 1(Neostigmine EP Impurity A Metilsulfate), 3-Hydroxy-N,N,N-trimethylbenzenaminium methyl sulfate, 95%, 95%. Offered by: TRC, Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: 250mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3-hydroxyphenyl)-trimethylazanium;methyl sulfate (CAS 4312-54-3) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: (3-hydroxyphenyl)-trimethylazanium;methyl sulfate. InChIKey: UVYIYCBDEGQPEJ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | (3-hydroxyphenyl)-trimethylazanium;methyl sulfate |
| InChIKey | UVYIYCBDEGQPEJ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C1=CC(=CC=C1)O.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)