CAS 2243075-40-1 is the registry number for (R)-tert-Butyl 4-cyclopropyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 2243075-40-1) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: tert-butyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: IPCPWQJPVQDUKZ-QMMMGPOBSA-N.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | tert-butyl (4R)-4-cyclopropyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | IPCPWQJPVQDUKZ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COS1(=O)=O)C2CC2 |
Computed by PubChem (NCBI)