CAS 1174657-07-8 appears in our catalog under these names: (R)-7-((2-Amino-2-carboxyethyl)thio)-2-oxoheptanoic acid, 98%, 7-(((2R)-2-Amino-2-carboxyethyl)thio)-2-oxo-heptanoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
7-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-oxoheptanoic acid (CAS 1174657-07-8) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: 7-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-oxoheptanoic acid. InChIKey: NPAOQOWXVDEARX-ZETCQYMHSA-N.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | 7-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-oxoheptanoic acid |
| InChIKey | NPAOQOWXVDEARX-ZETCQYMHSA-N |
| SMILES | C(CCC(=O)C(=O)O)CCSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)