CAS 183606-83-9 appears in our catalog under these names: tert-Butyl (1,1-dioxido-3-oxotetrahydro-2H-thiopyran-4-yl)carbamate, 98%, N-​(Tetrahydro-​1,​1-​dioxido-​3-​oxo-​2H-​thiopyran-​4-​yl)​-​carbamic acid 1,​1-​dimethylethyl ester. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-(1,1,3-trioxothian-4-yl)carbamate (CAS 183606-83-9) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: tert-butyl N-(1,1,3-trioxothian-4-yl)carbamate. InChIKey: RJQRXKCRDWVGBQ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | tert-butyl N-(1,1,3-trioxothian-4-yl)carbamate |
| InChIKey | RJQRXKCRDWVGBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCS(=O)(=O)CC1=O |
Computed by PubChem (NCBI)