CAS 2227204-96-6 is the registry number for tert-Butyl 7-oxa-6-thia-5-azaspiro[3.4]octane-5-carboxylate 6,6-dioxide 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 6,6-dioxo-7-oxa-6lambda6-thia-5-azaspiro[3.4]octane-5-carboxylate (CAS 2227204-96-6) is a chemical compound with the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. IUPAC name: tert-butyl 6,6-dioxo-7-oxa-6lambda6-thia-5-azaspiro[3.4]octane-5-carboxylate. InChIKey: QNQYINKTZPUUMY-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | tert-butyl 6,6-dioxo-7-oxa-6lambda6-thia-5-azaspiro[3.4]octane-5-carboxylate |
| InChIKey | QNQYINKTZPUUMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2(CCC2)COS1(=O)=O |
Computed by PubChem (NCBI)