CAS 106473-45-4 appears in our catalog under these names: 1-(1H-Benzimidazol-2-yl)-1-phenylmethanamine dihydrochloride, 95%, (1H-Benzo[d]imidazol-2-yl)(phenyl)methanamine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
1H-benzimidazol-2-yl(phenyl)methanamine;dihydrochloride (CAS 106473-45-4) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: 1H-benzimidazol-2-yl(phenyl)methanamine;dihydrochloride. InChIKey: JZMHXCJWCWJXNG-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 1H-benzimidazol-2-yl(phenyl)methanamine;dihydrochloride |
| InChIKey | JZMHXCJWCWJXNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=NC3=CC=CC=C3N2)N.Cl.Cl |
Computed by PubChem (NCBI)