Products 1807753-04-3
CAS 1807753-04-3 is the registry number for 4,6-Dichloro-N-mesityl-2-methylpyrimidin-5-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4,6-dichloro-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidin-5-amine (CAS 1807753-04-3) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: 4,6-dichloro-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidin-5-amine. InChIKey: JTEJUIBLZVPVEB-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,6-dichloro-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidin-5-amine |
| InChIKey | JTEJUIBLZVPVEB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=C(N=C(N=C2Cl)C)Cl)C |
Computed by PubChem (NCBI)