CAS 1354951-93-1 is the registry number for 1H-1,3-Benzodiazol-5-yl(phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3H-benzimidazol-5-yl(phenyl)methanamine;dihydrochloride (CAS 1354951-93-1) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: 3H-benzimidazol-5-yl(phenyl)methanamine;dihydrochloride. InChIKey: NGJNPYKFEGJVSF-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 3H-benzimidazol-5-yl(phenyl)methanamine;dihydrochloride |
| InChIKey | NGJNPYKFEGJVSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC3=C(C=C2)N=CN3)N.Cl.Cl |
Computed by PubChem (NCBI)