CAS 1197822-55-1 appears in our catalog under these names: 2-(1H-1,3-Benzodiazol-2-yl)-4-methylaniline dihydrochloride, 95%, 2-(1H-1,3-Benzodiazol-2-yl)-4-methylaniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(1H-benzimidazol-2-yl)-4-methylaniline;dihydrochloride (CAS 1197822-55-1) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: 2-(1H-benzimidazol-2-yl)-4-methylaniline;dihydrochloride. InChIKey: LGICAKWQAMJYOA-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-yl)-4-methylaniline;dihydrochloride |
| InChIKey | LGICAKWQAMJYOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)C2=NC3=CC=CC=C3N2.Cl.Cl |
Computed by PubChem (NCBI)