CAS 1458593-59-3 is the registry number for (2-(1H-1,3-Benzodiazol-1-yl)phenyl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[2-(benzimidazol-1-yl)phenyl]methanamine;dihydrochloride (CAS 1458593-59-3) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: [2-(benzimidazol-1-yl)phenyl]methanamine;dihydrochloride. InChIKey: FSWXCHMNYKXFHL-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | [2-(benzimidazol-1-yl)phenyl]methanamine;dihydrochloride |
| InChIKey | FSWXCHMNYKXFHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)N2C=NC3=CC=CC=C32.Cl.Cl |
Computed by PubChem (NCBI)