CAS 1573547-78-0 is the registry number for 2-((1H-Benzo[d]imidazol-2-yl)methyl)aniline dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1H-benzimidazol-2-ylmethyl)aniline;dihydrochloride (CAS 1573547-78-0) is a chemical compound with the molecular formula C14H15Cl2N3 and a molecular weight of 296.2 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylmethyl)aniline;dihydrochloride. InChIKey: AWRHOCNLSORPDW-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylmethyl)aniline;dihydrochloride |
| InChIKey | AWRHOCNLSORPDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NC3=CC=CC=C3N2)N.Cl.Cl |
Computed by PubChem (NCBI)