Products 106644-43-3
CAS 106644-43-3 appears in our catalog under these names: rac-Amoxicillin EP Impurity H, 2-(4-Hydroxyphenyl)-2-pivalamidoacetic acid, 95%, Amoxicillin Impurity 18（rac-Amoxicillin EP Impurity H）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 106644-43-3) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: BSXQHKOBFTYRJX-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | BSXQHKOBFTYRJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC(C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)