CAS 205826-86-4 appears in our catalog under these names: Boc-D-Phg(4-OH)-OH 95%, Amoxicillin EP Impurity H, (R)-a-((2,2-Dimethyl-1-oxopropyl)amino)-4-hydroxybenzeneacetic Acid, >95% (HPLC), (R)-alpha-((2,2-Dimethyl-1-oxopropyl)amino)-4-hydroxybenzeneacetic Acid, >95% (HPLC), (2R)-2-((2,2-Dimethylpropanoyl)amino)-2-(4-hydroxyphenyl)acetic Acid. Offered by: Ambeed, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 10mg, 25mg, 100mg, on request, 10g, 1g, 0,05g, 1000mg.
(2R)-2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 205826-86-4) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: (2R)-2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: BSXQHKOBFTYRJX-SNVBAGLBSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2R)-2-(2,2-dimethylpropanoylamino)-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | BSXQHKOBFTYRJX-SNVBAGLBSA-N |
| SMILES | CC(C)(C)C(=O)N[C@H](C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)