Products 1067224-41-2
CAS 1067224-41-2 is the registry number for Epicoccone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6,7-trihydroxy-4-methyl-3H-2-benzofuran-1-one (CAS 1067224-41-2) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 5,6,7-trihydroxy-4-methyl-3H-2-benzofuran-1-one. InChIKey: IREYRQPUBOQACQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5,6,7-trihydroxy-4-methyl-3H-2-benzofuran-1-one |
| InChIKey | IREYRQPUBOQACQ-UHFFFAOYSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1O)O)O |
Computed by PubChem (NCBI)