CAS 106754-18-1 is the registry number for 4-Hydroxy Coumarin-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg.
5,6,7,8-tetradeuterio-4-hydroxychromen-2-one (CAS 106754-18-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 166.17 g/mol. IUPAC name: 5,6,7,8-tetradeuterio-4-hydroxychromen-2-one. InChIKey: VXIXUWQIVKSKSA-RHQRLBAQSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | 5,6,7,8-tetradeuterio-4-hydroxychromen-2-one |
| InChIKey | VXIXUWQIVKSKSA-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=CC(=O)O2)O)[2H])[2H] |
Computed by PubChem (NCBI)