Products 1068144-14-8

CAS 1068144-14-8 is the registry number for Benzo[d]oxazole-4-sulfonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

1,3-benzoxazole-4-sulfonyl chloride (CAS 1068144-14-8) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 1,3-benzoxazole-4-sulfonyl chloride. InChIKey: UFMUDLWRUMZPSI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClNO3S
Molecular weight217.63 g/mol
IUPAC name1,3-benzoxazole-4-sulfonyl chloride
InChIKeyUFMUDLWRUMZPSI-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CO2

Computed by PubChem (NCBI)