CAS 46149-10-4 appears in our catalog under these names: 6-Chlorobenzo[d]isothiazol-3(2h)-one 1,1-dioxide, 95%, 6-Chlorobenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97%, 6-Chlorobenzo[D]Isothiazol-3(2H)-One 1,1-Dioxide, 97%, 97%, 6-Chloro-1,1-dioxo-1,2-dihydro-1-benzo[d]isothiazol-3-one, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-chloro-1,1-dioxo-1,2-benzothiazol-3-one (CAS 46149-10-4) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 6-chloro-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: QQRRMRLXOFZGIB-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 6-chloro-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | QQRRMRLXOFZGIB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)