CAS 1781899-50-0 is the registry number for Benzo[d]oxazole-7-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-benzoxazole-7-sulfonyl chloride (CAS 1781899-50-0) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 1,3-benzoxazole-7-sulfonyl chloride. InChIKey: UMTOBARUDRSVJT-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 1,3-benzoxazole-7-sulfonyl chloride |
| InChIKey | UMTOBARUDRSVJT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)OC=N2 |
Computed by PubChem (NCBI)