CAS 5769-15-3 is the registry number for 4-Chlorobenzenesulfonyl Isocyanate. Offered by: TRC. Available pack sizes: 250mg, 500mg.
4-chloro-N-(oxomethylidene)benzenesulfonamide (CAS 5769-15-3) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 4-chloro-N-(oxomethylidene)benzenesulfonamide. InChIKey: JGHDVROWMPBQSR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 4-chloro-N-(oxomethylidene)benzenesulfonamide |
| InChIKey | JGHDVROWMPBQSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N=C=O)Cl |
Computed by PubChem (NCBI)