CAS 78224-92-7 is the registry number for 1,2,3–Benzoxathiazine, 6–chloro–, 2,2–dioxide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-chloro-1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 78224-92-7) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 6-chloro-1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: FSJOTWFQOBRYKY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 6-chloro-1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | FSJOTWFQOBRYKY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C=NS(=O)(=O)O2 |
Computed by PubChem (NCBI)