CAS 6752-38-1 appears in our catalog under these names: 4-(Chlorosulfonyl)phenyl isocyanate, 95%, 4-(CHLOROSULFONYL)PHENYL ISOCYANATE, 97%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg.
4-isocyanatobenzenesulfonyl chloride (CAS 6752-38-1) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 4-isocyanatobenzenesulfonyl chloride. InChIKey: PUXGCFRABSKGED-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3S |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 4-isocyanatobenzenesulfonyl chloride |
| InChIKey | PUXGCFRABSKGED-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)