Products 6752-38-1

CAS 6752-38-1 appears in our catalog under these names: 4-(Chlorosulfonyl)phenyl isocyanate, 95%, 4-(CHLOROSULFONYL)PHENYL ISOCYANATE, 97%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-isocyanatobenzenesulfonyl chloride (CAS 6752-38-1) is a chemical compound with the molecular formula C7H4ClNO3S and a molecular weight of 217.63 g/mol. IUPAC name: 4-isocyanatobenzenesulfonyl chloride. InChIKey: PUXGCFRABSKGED-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClNO3S
Molecular weight217.63 g/mol
IUPAC name4-isocyanatobenzenesulfonyl chloride
InChIKeyPUXGCFRABSKGED-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N=C=O)S(=O)(=O)Cl

Computed by PubChem (NCBI)