CAS 106854-89-1 is the registry number for 4-Benzyl-6,7-dihydroxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-benzyl-6,7-dihydroxychromen-2-one (CAS 106854-89-1) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 4-benzyl-6,7-dihydroxychromen-2-one. InChIKey: JUMDNDOJGTXTQJ-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4-benzyl-6,7-dihydroxychromen-2-one |
| InChIKey | JUMDNDOJGTXTQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=O)OC3=CC(=C(C=C23)O)O |
Computed by PubChem (NCBI)