Products 106860-70-2

CAS 106860-70-2 is the registry number for Apremilast Impurity 47. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-nitrosophthalic acid (CAS 106860-70-2) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 3-nitrosophthalic acid. InChIKey: HHUBRUYPYDODRB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO5
Molecular weight195.13 g/mol
IUPAC name3-nitrosophthalic acid
InChIKeyHHUBRUYPYDODRB-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)N=O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)