CAS 106860-70-2 is the registry number for Apremilast Impurity 47. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-nitrosophthalic acid (CAS 106860-70-2) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 3-nitrosophthalic acid. InChIKey: HHUBRUYPYDODRB-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 3-nitrosophthalic acid |
| InChIKey | HHUBRUYPYDODRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)