CAS 39830-64-3 is the registry number for 3-Hydroxy-4-nitro-3H-isobenzofuran-1-one. Offered by: Mikromol. Available pack sizes: 25mg.
3-hydroxy-4-nitro-3H-2-benzofuran-1-one (CAS 39830-64-3) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 3-hydroxy-4-nitro-3H-2-benzofuran-1-one. InChIKey: QUWCDANYAUHCRM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 3-hydroxy-4-nitro-3H-2-benzofuran-1-one |
| InChIKey | QUWCDANYAUHCRM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(OC2=O)O)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)