Products 14922-36-2
CAS 14922-36-2 appears in our catalog under these names: 2–(4–Nitrophenyl)–2–oxoacetic acid, 2-(4-Nitrophenyl)-2-oxoacetic acid 95%, 2-(4-Nitrophenyl)-2-oxoacetic acid, 95%, 2-(4-nitrophenyl)-2-oxoacetic acid, 95%, 95%, 4-Nitrophenylglyoxylic Acid, >95% (HPLC). Offered by: GLPBio, Ambeed, Fluorochem, Chemat, TRC. Available pack sizes: 10g, 1g, 250mg, 25g, 5g, 100mg, 500mg.
2-(4-nitrophenyl)-2-oxoacetic acid (CAS 14922-36-2) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 2-(4-nitrophenyl)-2-oxoacetic acid. InChIKey: RREPYIWLDJQENS-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-2-oxoacetic acid |
| InChIKey | RREPYIWLDJQENS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophenylglyoxylic acid, Npga acid, p-Nitrophenylglyoxylic acid, 2-(4-nitrophenyl)-2-oxoacetic acid, 4-Nitrophenyloxoacetic Acid, Benzeneacetic acid, 4-nitro-alpha-oxo-, Glyoxylic acid, (4-nitrophenyl)-, (4-Nitrophenyl)(oxo)acetic acid, (4-Nitro-phenyl)-oxo-acetic acid, (4-nitro-phenyl)glyoxylic acid