Products 1092931-93-5
CAS 1092931-93-5 appears in our catalog under these names: 3-Formyl-4-nitrobenzoic acid 95%, 3-Formyl-4-nitrobenzoic acid, 95%, 95%, 3-Formyl-4-nitrobenzoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
3-formyl-4-nitrobenzoic acid (CAS 1092931-93-5) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 3-formyl-4-nitrobenzoic acid. InChIKey: SPTXSDMRZNPVKQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 3-formyl-4-nitrobenzoic acid |
| InChIKey | SPTXSDMRZNPVKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)