Products 7464-91-7
CAS 7464-91-7 appears in our catalog under these names: 2-Formyl-5-nitro-benzoic acid, 2-Formyl-5-Nitrobenzoic acid, 95+%. Offered by: Fluorochem, Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-formyl-5-nitrobenzoic acid (CAS 7464-91-7) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 2-formyl-5-nitrobenzoic acid. InChIKey: IQZDAZHSOLMQJD-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 2-formyl-5-nitrobenzoic acid |
| InChIKey | IQZDAZHSOLMQJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C=O |
Computed by PubChem (NCBI)