Products 604000-99-9
CAS 604000-99-9 appears in our catalog under these names: 4-Formyl-3-nitrobenzoic acid, 4-Formyl-3-nitrobenzoic acid, 98%, 4-Formyl-3-nitrobenzoic acid, 95%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
4-formyl-3-nitrobenzoic acid (CAS 604000-99-9) is a chemical compound with the molecular formula C8H5NO5 and a molecular weight of 195.13 g/mol. IUPAC name: 4-formyl-3-nitrobenzoic acid. InChIKey: NGLYFQZZXYWIRA-UHFFFAOYSA-N.
| Molecular formula | C8H5NO5 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 4-formyl-3-nitrobenzoic acid |
| InChIKey | NGLYFQZZXYWIRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)