CAS 107097-06-3 appears in our catalog under these names: N-Methyl-5-phenyl-1,3,4-thiadiazol-2-amine hydrochloride, 95%, N-Methyl-5-phenyl-1,3,4-thiadiazol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-methyl-5-phenyl-1,3,4-thiadiazol-2-amine;hydrochloride (CAS 107097-06-3) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: N-methyl-5-phenyl-1,3,4-thiadiazol-2-amine;hydrochloride. InChIKey: SVRFDTGLRYGIMI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | N-methyl-5-phenyl-1,3,4-thiadiazol-2-amine;hydrochloride |
| InChIKey | SVRFDTGLRYGIMI-UHFFFAOYSA-N |
| SMILES | CNC1=NN=C(S1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)