CAS 1955499-06-5 appears in our catalog under these names: 5-Benzyl-1,3,4-thiadiazol-2-amine hydrochloride, 5-Benzyl-1,3,4-thiadiazol-2-amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
5-benzyl-1,3,4-thiadiazol-2-amine;hydrochloride (CAS 1955499-06-5) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: 5-benzyl-1,3,4-thiadiazol-2-amine;hydrochloride. InChIKey: CKXCNZNLHLDAIU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | 5-benzyl-1,3,4-thiadiazol-2-amine;hydrochloride |
| InChIKey | CKXCNZNLHLDAIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NN=C(S2)N.Cl |
Computed by PubChem (NCBI)