Products 60912-78-9

CAS 60912-78-9 is the registry number for 2-Amino-5-phenyl-6h-[1,3,4]thiadiazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride (CAS 60912-78-9) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: 5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride. InChIKey: FWCMBEVJMSPOID-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClN3S
Molecular weight227.71 g/mol
IUPAC name5-phenyl-6H-1,3,4-thiadiazin-2-amine;hydrochloride
InChIKeyFWCMBEVJMSPOID-UHFFFAOYSA-N
SMILESC1C(=NN=C(S1)N)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)