Products 112941-27-2
CAS 112941-27-2 appears in our catalog under these names: {((2-Cyanophenyl)methyl)sulfanyl}methanimidamide hydrochloride, {[(2-cyanophenyl)methyl]sulfanyl}methanimidamide hydrochloride, 95%, {((2-cyanophenyl)methyl)sulfanyl}methanimidamide hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
(2-cyanophenyl)methyl carbamimidothioate;hydrochloride (CAS 112941-27-2) is a chemical compound with the molecular formula C9H10ClN3S and a molecular weight of 227.71 g/mol. IUPAC name: (2-cyanophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: DZGMYDLFEPNNKE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3S |
|---|---|
| Molecular weight | 227.71 g/mol |
| IUPAC name | (2-cyanophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | DZGMYDLFEPNNKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC(=N)N)C#N.Cl |
Computed by PubChem (NCBI)